C40H46BrOPSi — CID 11802691
[(5S)-5-[tert-butyl(diphenyl)silyl]oxyhexyl]-triphenylphosphanium bromide (PubChem CID 11802691) has the molecular formula C40H46BrOPSi and a molecular weight of 681.77 g/mol. Its IUPAC name is [(5S)-5-[tert-butyl(diphenyl)silyl]oxyhexyl]-triphenylphosphanium bromide.
| Compound Name | [(5S)-5-[tert-butyl(diphenyl)silyl]oxyhexyl]-triphenylphosphanium bromide |
|---|---|
| PubChem CID | 11802691 |
| Molecular Formula | C40H46BrOPSi |
| Molecular Weight | 681.77 g/mol |
| Exact Mass | 680.22 |
| IUPAC Name | [(5S)-5-[tert-butyl(diphenyl)silyl]oxyhexyl]-triphenylphosphanium bromide |
| SMILES | C[C@@H](CCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C.[Br-] |
| InChI | InChI=1S/C40H46OPSi.BrH/c1-34(41-43(40(2,3)4,38-29-16-8-17-30-38)39-31-18-9-19-32-39)22-20-21-33-42(35-23-10-5-11-24-35,36-25-12-6-13-26-36)37-27-14-7-15-28-37;/h5-19,23-32,34H,20-22,33H2,1-4H3;1H/q+1;/p-1/t34-;/m0./s1 |
| InChIKey | ZBAJLNPAXQMSKG-GXUZKUJRSA-M |
| XLogP | 5.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.77 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|