C34H48O2Si — CID 153316530
(17S)-17-[tert-butyl(diphenyl)silyl]oxyoctadeca-4,12-diyn-1-ol (PubChem CID 153316530) has the molecular formula C34H48O2Si and a molecular weight of 516.84 g/mol. Its IUPAC name is (17S)-17-[tert-butyl(diphenyl)silyl]oxyoctadeca-4,12-diyn-1-ol.
| Compound Name | (17S)-17-[tert-butyl(diphenyl)silyl]oxyoctadeca-4,12-diyn-1-ol |
|---|---|
| PubChem CID | 153316530 |
| Molecular Formula | C34H48O2Si |
| Molecular Weight | 516.84 g/mol |
| Exact Mass | 516.34 |
| IUPAC Name | (17S)-17-[tert-butyl(diphenyl)silyl]oxyoctadeca-4,12-diyn-1-ol |
| SMILES | C[C@@H](CCCC#CCCCCCCC#CCCCO)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C34H48O2Si/c1-31(25-19-15-13-11-9-7-5-6-8-10-12-14-16-24-30-35)36-37(34(2,3)4,32-26-20-17-21-27-32)33-28-22-18-23-29-33/h17-18,20-23,26-29,31,35H,5-10,15-16,19,24-25,30H2,1-4H3/t31-/m0/s1 |
| InChIKey | CXLADWQTZMUEMZ-HKBQPEDESA-N |
| XLogP | 7.24 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.84 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|