C21H30O4SSi — CID 172708913
(4S)-4-[tert-butyl(diphenyl)silyl]oxypentane-1-sulfonic acid (PubChem CID 172708913) has the molecular formula C21H30O4SSi and a molecular weight of 406.62 g/mol. Its IUPAC name is (4S)-4-[tert-butyl(diphenyl)silyl]oxypentane-1-sulfonic acid.
| Compound Name | (4S)-4-[tert-butyl(diphenyl)silyl]oxypentane-1-sulfonic acid |
|---|---|
| PubChem CID | 172708913 |
| Molecular Formula | C21H30O4SSi |
| Molecular Weight | 406.62 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | (4S)-4-[tert-butyl(diphenyl)silyl]oxypentane-1-sulfonic acid |
| SMILES | C[C@@H](CCCS(=O)(=O)O)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C21H30O4SSi/c1-18(12-11-17-26(22,23)24)25-27(21(2,3)4,19-13-7-5-8-14-19)20-15-9-6-10-16-20/h5-10,13-16,18H,11-12,17H2,1-4H3,(H,22,23,24)/t18-/m0/s1 |
| InChIKey | DZARJNTUGKOOQE-SFHVURJKSA-N |
| XLogP | 3.62 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.62 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|