C29H36O2Si — CID 122207638
(2R,5R)-5-[tert-butyl(diphenyl)silyl]oxy-2-methyl-1-phenylhexan-1-one (PubChem CID 122207638) has the molecular formula C29H36O2Si and a molecular weight of 444.69 g/mol. Its IUPAC name is (2R,5R)-5-[tert-butyl(diphenyl)silyl]oxy-2-methyl-1-phenylhexan-1-one.
| Compound Name | (2R,5R)-5-[tert-butyl(diphenyl)silyl]oxy-2-methyl-1-phenylhexan-1-one |
|---|---|
| PubChem CID | 122207638 |
| Molecular Formula | C29H36O2Si |
| Molecular Weight | 444.69 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | (2R,5R)-5-[tert-butyl(diphenyl)silyl]oxy-2-methyl-1-phenylhexan-1-one |
| SMILES | C[C@H](CC[C@@H](C)C(=O)c1ccccc1)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H36O2Si/c1-23(28(30)25-15-9-6-10-16-25)21-22-24(2)31-32(29(3,4)5,26-17-11-7-12-18-26)27-19-13-8-14-20-27/h6-20,23-24H,21-22H2,1-5H3/t23-,24-/m1/s1 |
| InChIKey | KNHKRIUDURLWOW-DNQXCXABSA-N |
| XLogP | 6.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.69 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|