C21H29IOSi — CID 122389486
tert-butyl-[(2S)-5-iodopentan-2-yl]oxy-diphenylsilane (PubChem CID 122389486) has the molecular formula C21H29IOSi and a molecular weight of 452.45 g/mol. Its IUPAC name is tert-butyl-[(2S)-5-iodopentan-2-yl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[(2S)-5-iodopentan-2-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 122389486 |
| Molecular Formula | C21H29IOSi |
| Molecular Weight | 452.45 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | tert-butyl-[(2S)-5-iodopentan-2-yl]oxy-diphenylsilane |
| SMILES | C[C@@H](CCCI)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C21H29IOSi/c1-18(12-11-17-22)23-24(21(2,3)4,19-13-7-5-8-14-19)20-15-9-6-10-16-20/h5-10,13-16,18H,11-12,17H2,1-4H3/t18-/m0/s1 |
| InChIKey | WZODTXDSRGWNNM-SFHVURJKSA-N |
| XLogP | 5.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.45 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|