C22H29IO3Si — CID 134940913
(3S)-3-[tert-butyl(diphenyl)silyl]oxy-6-iodohexanoic acid (PubChem CID 134940913) has the molecular formula C22H29IO3Si and a molecular weight of 496.46 g/mol. Its IUPAC name is (3S)-3-[tert-butyl(diphenyl)silyl]oxy-6-iodohexanoic acid.
| Compound Name | (3S)-3-[tert-butyl(diphenyl)silyl]oxy-6-iodohexanoic acid |
|---|---|
| PubChem CID | 134940913 |
| Molecular Formula | C22H29IO3Si |
| Molecular Weight | 496.46 g/mol |
| Exact Mass | 496.09 |
| IUPAC Name | (3S)-3-[tert-butyl(diphenyl)silyl]oxy-6-iodohexanoic acid |
| SMILES | CC(C)(C)[Si](O[C@@H](CCCI)CC(=O)O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H29IO3Si/c1-22(2,3)27(19-12-6-4-7-13-19,20-14-8-5-9-15-20)26-18(11-10-16-23)17-21(24)25/h4-9,12-15,18H,10-11,16-17H2,1-3H3,(H,24,25)/t18-/m0/s1 |
| InChIKey | MRSDNZRPHCTTQL-SFHVURJKSA-N |
| XLogP | 4.62 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.46 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|