C62H80O12Si2 — CID 160785231
3-[tert-butyl(diphenyl)silyl]oxy-5-(2,3,4-trimethoxyphenyl)pentanoic acid;ethyl 3-[tert-butyl(diphenyl)silyl]oxy-5-(2,3,4-trimethoxyphenyl)pentanoate (PubChem CID 160785231) has the molecular formula C62H80O12Si2 and a molecular weight of 1073.48 g/mol. Its IUPAC name is 3-[tert-butyl(diphenyl)silyl]oxy-5-(2,3,4-trimethoxyphenyl)pentanoic acid;ethyl 3-[tert-butyl(diphenyl)silyl]oxy-5-(2,3,4-trimethoxyphenyl)pentanoate.
| Compound Name | 3-[tert-butyl(diphenyl)silyl]oxy-5-(2,3,4-trimethoxyphenyl)pentanoic acid;ethyl 3-[tert-butyl(diphenyl)silyl]oxy-5-(2,3,4-trimethoxyphenyl)pentanoate |
|---|---|
| PubChem CID | 160785231 |
| Molecular Formula | C62H80O12Si2 |
| Molecular Weight | 1073.48 g/mol |
| Exact Mass | 1072.52 |
| IUPAC Name | 3-[tert-butyl(diphenyl)silyl]oxy-5-(2,3,4-trimethoxyphenyl)pentanoic acid;ethyl 3-[tert-butyl(diphenyl)silyl]oxy-5-(2,3,4-trimethoxyphenyl)pentanoate |
| SMILES | CCOC(=O)CC(CCc1ccc(OC)c(OC)c1OC)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C.COc1ccc(CCC(CC(=O)O)O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)c(OC)c1OC |
| InChI | InChI=1S/C32H42O6Si.C30H38O6Si/c1-8-37-29(33)23-25(21-19-24-20-22-28(34-5)31(36-7)30(24)35-6)38-39(32(2,3)4,26-15-11-9-12-16-26)27-17-13-10-14-18-27;1-30(2,3)37(24-13-9-7-10-14-24,25-15-11-8-12-16-25)36-23(21-27(31)32)19-17-22-18-20-26(33-4)29(35-6)28(22)34-5/h9-18,20,22,25H,8,19,21,23H2,1-7H3;7-16,18,20,23H,17,19,21H2,1-6H3,(H,31,32) |
| InChIKey | SBCPENPGMANNLF-UHFFFAOYSA-N |
| XLogP | 10.61 |
| TPSA | 137.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 76 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1073.48 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|