C16H20ClNO3 — CID 2945823
ethyl 3-amino-3-(4-methoxynaphthalen-1-yl)propanoate;hydrochloride (PubChem CID 2945823) has the molecular formula C16H20ClNO3 and a molecular weight of 309.79 g/mol. Its IUPAC name is ethyl 3-amino-3-(4-methoxynaphthalen-1-yl)propanoate;hydrochloride.
| Compound Name | ethyl 3-amino-3-(4-methoxynaphthalen-1-yl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 2945823 |
| Molecular Formula | C16H20ClNO3 |
| Molecular Weight | 309.79 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | ethyl 3-amino-3-(4-methoxynaphthalen-1-yl)propanoate;hydrochloride |
| SMILES | CCOC(=O)CC(N)c1ccc(OC)c2ccccc12.Cl |
| InChI | InChI=1S/C16H19NO3.ClH/c1-3-20-16(18)10-14(17)12-8-9-15(19-2)13-7-5-4-6-11(12)13;/h4-9,14H,3,10,17H2,1-2H3;1H |
| InChIKey | IRDQVLVJFKXQHW-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.79 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |