C16H22ClNO — CID 171213236
(1R)-1-(4-methoxynaphthalen-1-yl)-3-methylbutan-1-amine;hydrochloride (PubChem CID 171213236) has the molecular formula C16H22ClNO and a molecular weight of 279.81 g/mol. Its IUPAC name is (1R)-1-(4-methoxynaphthalen-1-yl)-3-methylbutan-1-amine;hydrochloride.
| Compound Name | (1R)-1-(4-methoxynaphthalen-1-yl)-3-methylbutan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171213236 |
| Molecular Formula | C16H22ClNO |
| Molecular Weight | 279.81 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | (1R)-1-(4-methoxynaphthalen-1-yl)-3-methylbutan-1-amine;hydrochloride |
| SMILES | COc1ccc([C@H](N)CC(C)C)c2ccccc12.Cl |
| InChI | InChI=1S/C16H21NO.ClH/c1-11(2)10-15(17)13-8-9-16(18-3)14-7-5-4-6-12(13)14;/h4-9,11,15H,10,17H2,1-3H3;1H/t15-;/m1./s1 |
| InChIKey | VPUBWWSVHLCLCW-XFULWGLBSA-N |
| XLogP | 4.32 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.81 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |