C15H26ClNO — CID 171216456
(1R)-1-(2-methoxy-5-propan-2-ylphenyl)-3-methylbutan-1-amine;hydrochloride (PubChem CID 171216456) has the molecular formula C15H26ClNO and a molecular weight of 271.83 g/mol. Its IUPAC name is (1R)-1-(2-methoxy-5-propan-2-ylphenyl)-3-methylbutan-1-amine;hydrochloride.
| Compound Name | (1R)-1-(2-methoxy-5-propan-2-ylphenyl)-3-methylbutan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171216456 |
| Molecular Formula | C15H26ClNO |
| Molecular Weight | 271.83 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | (1R)-1-(2-methoxy-5-propan-2-ylphenyl)-3-methylbutan-1-amine;hydrochloride |
| SMILES | COc1ccc(C(C)C)cc1[C@H](N)CC(C)C.Cl |
| InChI | InChI=1S/C15H25NO.ClH/c1-10(2)8-14(16)13-9-12(11(3)4)6-7-15(13)17-5;/h6-7,9-11,14H,8,16H2,1-5H3;1H/t14-;/m1./s1 |
| InChIKey | XINHRLSCCOSIBV-PFEQFJNWSA-N |
| XLogP | 4.29 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.83 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |