C30H38O7Si — CID 71272796
methyl 3-[tert-butyl(diphenyl)silyl]oxy-4-(2,3,4-trimethoxyphenoxy)butanoate (PubChem CID 71272796) has the molecular formula C30H38O7Si and a molecular weight of 538.71 g/mol. Its IUPAC name is methyl 3-[tert-butyl(diphenyl)silyl]oxy-4-(2,3,4-trimethoxyphenoxy)butanoate.
| Compound Name | methyl 3-[tert-butyl(diphenyl)silyl]oxy-4-(2,3,4-trimethoxyphenoxy)butanoate |
|---|---|
| PubChem CID | 71272796 |
| Molecular Formula | C30H38O7Si |
| Molecular Weight | 538.71 g/mol |
| Exact Mass | 538.24 |
| IUPAC Name | methyl 3-[tert-butyl(diphenyl)silyl]oxy-4-(2,3,4-trimethoxyphenoxy)butanoate |
| SMILES | COC(=O)CC(COc1ccc(OC)c(OC)c1OC)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H38O7Si/c1-30(2,3)38(23-14-10-8-11-15-23,24-16-12-9-13-17-24)37-22(20-27(31)33-5)21-36-26-19-18-25(32-4)28(34-6)29(26)35-7/h8-19,22H,20-21H2,1-7H3 |
| InChIKey | HHUIDUPDQSILHD-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.71 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|