C23H31IO5Si — CID 10816311
methyl (3S,4S,5S)-6-[tert-butyl(diphenyl)silyl]oxy-3,4-dihydroxy-5-iodohexanoate (PubChem CID 10816311) has the molecular formula C23H31IO5Si and a molecular weight of 542.49 g/mol. Its IUPAC name is methyl (3S,4S,5S)-6-[tert-butyl(diphenyl)silyl]oxy-3,4-dihydroxy-5-iodohexanoate.
| Compound Name | methyl (3S,4S,5S)-6-[tert-butyl(diphenyl)silyl]oxy-3,4-dihydroxy-5-iodohexanoate |
|---|---|
| PubChem CID | 10816311 |
| Molecular Formula | C23H31IO5Si |
| Molecular Weight | 542.49 g/mol |
| Exact Mass | 542.10 |
| IUPAC Name | methyl (3S,4S,5S)-6-[tert-butyl(diphenyl)silyl]oxy-3,4-dihydroxy-5-iodohexanoate |
| SMILES | COC(=O)C[C@H](O)[C@H](O)[C@@H](I)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C23H31IO5Si/c1-23(2,3)30(17-11-7-5-8-12-17,18-13-9-6-10-14-18)29-16-19(24)22(27)20(25)15-21(26)28-4/h5-14,19-20,22,25,27H,15-16H2,1-4H3/t19-,20-,22+/m0/s1 |
| InChIKey | QBJLRMYXNUUGIM-JAXLGGSGSA-N |
| XLogP | 2.65 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.49 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|