C35H40O4Si — CID 11649711
methyl (3R,4S)-5-[tert-butyl(diphenyl)silyl]oxy-3-phenyl-4-phenylmethoxypentanoate (PubChem CID 11649711) has the molecular formula C35H40O4Si and a molecular weight of 552.79 g/mol. Its IUPAC name is methyl (3R,4S)-5-[tert-butyl(diphenyl)silyl]oxy-3-phenyl-4-phenylmethoxypentanoate.
| Compound Name | methyl (3R,4S)-5-[tert-butyl(diphenyl)silyl]oxy-3-phenyl-4-phenylmethoxypentanoate |
|---|---|
| PubChem CID | 11649711 |
| Molecular Formula | C35H40O4Si |
| Molecular Weight | 552.79 g/mol |
| Exact Mass | 552.27 |
| IUPAC Name | methyl (3R,4S)-5-[tert-butyl(diphenyl)silyl]oxy-3-phenyl-4-phenylmethoxypentanoate |
| SMILES | COC(=O)C[C@H](c1ccccc1)[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OCc1ccccc1 |
| InChI | InChI=1S/C35H40O4Si/c1-35(2,3)40(30-21-13-7-14-22-30,31-23-15-8-16-24-31)39-27-33(38-26-28-17-9-5-10-18-28)32(25-34(36)37-4)29-19-11-6-12-20-29/h5-24,32-33H,25-27H2,1-4H3/t32-,33-/m1/s1 |
| InChIKey | UMFQXKNJYXKLIV-CZNDPXEESA-N |
| XLogP | 6.50 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.79 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|