C38H46O5Si — CID 11082622
methyl (2S,3S,4S)-2-benzyl-5-[tert-butyl(diphenyl)silyl]oxy-3-methyl-4-(phenylmethoxymethoxy)pentanoate (PubChem CID 11082622) has the molecular formula C38H46O5Si and a molecular weight of 610.87 g/mol. Its IUPAC name is methyl (2S,3S,4S)-2-benzyl-5-[tert-butyl(diphenyl)silyl]oxy-3-methyl-4-(phenylmethoxymethoxy)pentanoate.
| Compound Name | methyl (2S,3S,4S)-2-benzyl-5-[tert-butyl(diphenyl)silyl]oxy-3-methyl-4-(phenylmethoxymethoxy)pentanoate |
|---|---|
| PubChem CID | 11082622 |
| Molecular Formula | C38H46O5Si |
| Molecular Weight | 610.87 g/mol |
| Exact Mass | 610.31 |
| IUPAC Name | methyl (2S,3S,4S)-2-benzyl-5-[tert-butyl(diphenyl)silyl]oxy-3-methyl-4-(phenylmethoxymethoxy)pentanoate |
| SMILES | COC(=O)[C@@H](Cc1ccccc1)[C@H](C)[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OCOCc1ccccc1 |
| InChI | InChI=1S/C38H46O5Si/c1-30(35(37(39)40-5)26-31-18-10-6-11-19-31)36(42-29-41-27-32-20-12-7-13-21-32)28-43-44(38(2,3)4,33-22-14-8-15-23-33)34-24-16-9-17-25-34/h6-25,30,35-36H,26-29H2,1-5H3/t30-,35-,36+/m0/s1 |
| InChIKey | ROKCZAODKFTJQP-BHQPUTRGSA-N |
| XLogP | 6.79 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.87 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|