C22H28O6 — CID 100972027
methyl (2S,3S,4S)-2-hydroxy-3-methyl-5-phenylmethoxy-4-(phenylmethoxymethoxy)pentanoate (PubChem CID 100972027) has the molecular formula C22H28O6 and a molecular weight of 388.46 g/mol. Its IUPAC name is methyl (2S,3S,4S)-2-hydroxy-3-methyl-5-phenylmethoxy-4-(phenylmethoxymethoxy)pentanoate.
| Compound Name | methyl (2S,3S,4S)-2-hydroxy-3-methyl-5-phenylmethoxy-4-(phenylmethoxymethoxy)pentanoate |
|---|---|
| PubChem CID | 100972027 |
| Molecular Formula | C22H28O6 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | methyl (2S,3S,4S)-2-hydroxy-3-methyl-5-phenylmethoxy-4-(phenylmethoxymethoxy)pentanoate |
| SMILES | COC(=O)[C@@H](O)[C@H](C)[C@@H](COCc1ccccc1)OCOCc1ccccc1 |
| InChI | InChI=1S/C22H28O6/c1-17(21(23)22(24)25-2)20(15-26-13-18-9-5-3-6-10-18)28-16-27-14-19-11-7-4-8-12-19/h3-12,17,20-21,23H,13-16H2,1-2H3/t17-,20-,21+/m1/s1 |
| InChIKey | ATNHBBKXENKIIM-UIFIKXQLSA-N |
| XLogP | 2.93 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|