C17H26O5 — CID 11209097
methyl (2S,3S,4R)-2-hydroxy-3,5-dimethyl-4-(phenylmethoxymethoxy)hexanoate (PubChem CID 11209097) has the molecular formula C17H26O5 and a molecular weight of 310.39 g/mol. Its IUPAC name is methyl (2S,3S,4R)-2-hydroxy-3,5-dimethyl-4-(phenylmethoxymethoxy)hexanoate.
| Compound Name | methyl (2S,3S,4R)-2-hydroxy-3,5-dimethyl-4-(phenylmethoxymethoxy)hexanoate |
|---|---|
| PubChem CID | 11209097 |
| Molecular Formula | C17H26O5 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | methyl (2S,3S,4R)-2-hydroxy-3,5-dimethyl-4-(phenylmethoxymethoxy)hexanoate |
| SMILES | COC(=O)[C@@H](O)[C@H](C)[C@H](OCOCc1ccccc1)C(C)C |
| InChI | InChI=1S/C17H26O5/c1-12(2)16(13(3)15(18)17(19)20-4)22-11-21-10-14-8-6-5-7-9-14/h5-9,12-13,15-16,18H,10-11H2,1-4H3/t13-,15-,16+/m0/s1 |
| InChIKey | ODHPPLRMIUIBNU-CWRNSKLLSA-N |
| XLogP | 2.37 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|