C25H34O5 — CID 12995255
methyl (2R,3S,4R,5R,6S)-3-hydroxy-2,4,6-trimethyl-5,7-bis(phenylmethoxy)heptanoate (PubChem CID 12995255) has the molecular formula C25H34O5 and a molecular weight of 414.54 g/mol. Its IUPAC name is methyl (2R,3S,4R,5R,6S)-3-hydroxy-2,4,6-trimethyl-5,7-bis(phenylmethoxy)heptanoate.
| Compound Name | methyl (2R,3S,4R,5R,6S)-3-hydroxy-2,4,6-trimethyl-5,7-bis(phenylmethoxy)heptanoate |
|---|---|
| PubChem CID | 12995255 |
| Molecular Formula | C25H34O5 |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | methyl (2R,3S,4R,5R,6S)-3-hydroxy-2,4,6-trimethyl-5,7-bis(phenylmethoxy)heptanoate |
| SMILES | COC(=O)[C@H](C)[C@@H](O)[C@@H](C)[C@H](OCc1ccccc1)[C@@H](C)COCc1ccccc1 |
| InChI | InChI=1S/C25H34O5/c1-18(15-29-16-21-11-7-5-8-12-21)24(30-17-22-13-9-6-10-14-22)19(2)23(26)20(3)25(27)28-4/h5-14,18-20,23-24,26H,15-17H2,1-4H3/t18-,19+,20+,23-,24+/m0/s1 |
| InChIKey | QQRCNWVXAYINKI-XARGLDOUSA-N |
| XLogP | 4.23 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |