C26H36O7 — CID 10906647
ethyl (2R,3S,4S,5S,6S)-2,3-dihydroxy-5-[(4-methoxyphenyl)methoxy]-4,6-dimethyl-7-phenylmethoxyheptanoate (PubChem CID 10906647) has the molecular formula C26H36O7 and a molecular weight of 460.57 g/mol. Its IUPAC name is ethyl (2R,3S,4S,5S,6S)-2,3-dihydroxy-5-[(4-methoxyphenyl)methoxy]-4,6-dimethyl-7-phenylmethoxyheptanoate.
| Compound Name | ethyl (2R,3S,4S,5S,6S)-2,3-dihydroxy-5-[(4-methoxyphenyl)methoxy]-4,6-dimethyl-7-phenylmethoxyheptanoate |
|---|---|
| PubChem CID | 10906647 |
| Molecular Formula | C26H36O7 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | ethyl (2R,3S,4S,5S,6S)-2,3-dihydroxy-5-[(4-methoxyphenyl)methoxy]-4,6-dimethyl-7-phenylmethoxyheptanoate |
| SMILES | CCOC(=O)[C@H](O)[C@@H](O)[C@H](C)[C@@H](OCc1ccc(OC)cc1)[C@@H](C)COCc1ccccc1 |
| InChI | InChI=1S/C26H36O7/c1-5-32-26(29)24(28)23(27)19(3)25(33-17-21-11-13-22(30-4)14-12-21)18(2)15-31-16-20-9-7-6-8-10-20/h6-14,18-19,23-25,27-28H,5,15-17H2,1-4H3/t18-,19-,23-,24+,25-/m0/s1 |
| InChIKey | VSGNNFBEACBLEH-HKTXXRBESA-N |
| XLogP | 3.35 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |