C26H38O3 — CID 134836814
(2R,3R,4S,5R,6R)-2,4,6-trimethyl-1,3-bis(phenylmethoxy)nonan-5-ol (PubChem CID 134836814) has the molecular formula C26H38O3 and a molecular weight of 398.59 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-2,4,6-trimethyl-1,3-bis(phenylmethoxy)nonan-5-ol.
| Compound Name | (2R,3R,4S,5R,6R)-2,4,6-trimethyl-1,3-bis(phenylmethoxy)nonan-5-ol |
|---|---|
| PubChem CID | 134836814 |
| Molecular Formula | C26H38O3 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.28 |
| IUPAC Name | (2R,3R,4S,5R,6R)-2,4,6-trimethyl-1,3-bis(phenylmethoxy)nonan-5-ol |
| SMILES | CCC[C@@H](C)[C@@H](O)[C@H](C)[C@H](OCc1ccccc1)[C@H](C)COCc1ccccc1 |
| InChI | InChI=1S/C26H38O3/c1-5-12-20(2)25(27)22(4)26(29-19-24-15-10-7-11-16-24)21(3)17-28-18-23-13-8-6-9-14-23/h6-11,13-16,20-22,25-27H,5,12,17-19H2,1-4H3/t20-,21-,22+,25-,26-/m1/s1 |
| InChIKey | QGGQQSPZCNVYPT-HRNWHPSISA-N |
| XLogP | 5.86 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |