C21H28O4 — CID 13182124
(2R,3S,4S)-1,2-bis(phenylmethoxy)heptane-3,4-diol (PubChem CID 13182124) has the molecular formula C21H28O4 and a molecular weight of 344.45 g/mol. Its IUPAC name is (2R,3S,4S)-1,2-bis(phenylmethoxy)heptane-3,4-diol.
| Compound Name | (2R,3S,4S)-1,2-bis(phenylmethoxy)heptane-3,4-diol |
|---|---|
| PubChem CID | 13182124 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | (2R,3S,4S)-1,2-bis(phenylmethoxy)heptane-3,4-diol |
| SMILES | CCC[C@H](O)[C@H](O)[C@@H](COCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C21H28O4/c1-2-9-19(22)21(23)20(25-15-18-12-7-4-8-13-18)16-24-14-17-10-5-3-6-11-17/h3-8,10-13,19-23H,2,9,14-16H2,1H3/t19-,20+,21-/m0/s1 |
| InChIKey | SDLJINHREOGFNA-HBMCJLEFSA-N |
| XLogP | 3.31 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |