C82H86O12 — CID 10653976
(2S,3R,4R,5S,6S,7S,8R,9S,10R,11R)-2,3,4,6,7,8,9,10,11,12-decakis(phenylmethoxy)dodecane-1,5-diol (PubChem CID 10653976) has the molecular formula C82H86O12 and a molecular weight of 1263.58 g/mol. Its IUPAC name is (2S,3R,4R,5S,6S,7S,8R,9S,10R,11R)-2,3,4,6,7,8,9,10,11,12-decakis(phenylmethoxy)dodecane-1,5-diol.
| Compound Name | (2S,3R,4R,5S,6S,7S,8R,9S,10R,11R)-2,3,4,6,7,8,9,10,11,12-decakis(phenylmethoxy)dodecane-1,5-diol |
|---|---|
| PubChem CID | 10653976 |
| Molecular Formula | C82H86O12 |
| Molecular Weight | 1263.58 g/mol |
| Exact Mass | 1262.61 |
| IUPAC Name | (2S,3R,4R,5S,6S,7S,8R,9S,10R,11R)-2,3,4,6,7,8,9,10,11,12-decakis(phenylmethoxy)dodecane-1,5-diol |
| SMILES | OC[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@H](O)[C@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](COCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C82H86O12/c83-51-73(86-53-64-33-13-2-14-34-64)76(88-55-66-37-17-4-18-38-66)78(90-57-68-41-21-6-22-42-68)75(84)79(91-58-69-43-23-7-24-44-69)81(93-60-71-47-27-9-28-48-71)82(94-61-72-49-29-10-30-50-72)80(92-59-70-45-25-8-26-46-70)77(89-56-67-39-19-5-20-40-67)74(87-54-65-35-15-3-16-36-65)62-85-52-63-31-11-1-12-32-63/h1-50,73-84H,51-62H2/t73-,74+,75-,76+,77+,78+,79-,80-,81-,82-/m0/s1 |
| InChIKey | HLFCTTBCYSWPOC-QCELQLGJSA-N |
| XLogP | 14.82 |
| TPSA | 132.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 94 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1263.58 |
| LogP ≤ 5 | 14.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |