C50H54O8 — CID 10985612
1-methoxy-4-[[(2R,3R,4R,5R)-4-[(4-methoxyphenyl)methoxy]-1,2,5,6-tetrakis(phenylmethoxy)hexan-3-yl]oxymethyl]benzene (PubChem CID 10985612) has the molecular formula C50H54O8 and a molecular weight of 782.97 g/mol. Its IUPAC name is 1-methoxy-4-[[(2R,3R,4R,5R)-4-[(4-methoxyphenyl)methoxy]-1,2,5,6-tetrakis(phenylmethoxy)hexan-3-yl]oxymethyl]benzene.
| Compound Name | 1-methoxy-4-[[(2R,3R,4R,5R)-4-[(4-methoxyphenyl)methoxy]-1,2,5,6-tetrakis(phenylmethoxy)hexan-3-yl]oxymethyl]benzene |
|---|---|
| PubChem CID | 10985612 |
| Molecular Formula | C50H54O8 |
| Molecular Weight | 782.97 g/mol |
| Exact Mass | 782.38 |
| IUPAC Name | 1-methoxy-4-[[(2R,3R,4R,5R)-4-[(4-methoxyphenyl)methoxy]-1,2,5,6-tetrakis(phenylmethoxy)hexan-3-yl]oxymethyl]benzene |
| SMILES | COc1ccc(CO[C@@H]([C@H](OCc2ccc(OC)cc2)[C@@H](COCc2ccccc2)OCc2ccccc2)[C@@H](COCc2ccccc2)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C50H54O8/c1-51-45-27-23-43(24-28-45)35-57-49(47(55-33-41-19-11-5-12-20-41)37-53-31-39-15-7-3-8-16-39)50(58-36-44-25-29-46(52-2)30-26-44)48(56-34-42-21-13-6-14-22-42)38-54-32-40-17-9-4-10-18-40/h3-30,47-50H,31-38H2,1-2H3/t47-,48-,49-,50-/m1/s1 |
| InChIKey | KIHQYQWEIQPXMC-SGGCHTPCSA-N |
| XLogP | 9.78 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.97 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |