C19H22O4 — CID 140633194
(2R)-2-[(1S)-2-[(4-methoxyphenyl)methoxy]-1-phenylmethoxyethyl]oxirane (PubChem CID 140633194) has the molecular formula C19H22O4 and a molecular weight of 314.38 g/mol. Its IUPAC name is (2R)-2-[(1S)-2-[(4-methoxyphenyl)methoxy]-1-phenylmethoxyethyl]oxirane.
| Compound Name | (2R)-2-[(1S)-2-[(4-methoxyphenyl)methoxy]-1-phenylmethoxyethyl]oxirane |
|---|---|
| PubChem CID | 140633194 |
| Molecular Formula | C19H22O4 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | (2R)-2-[(1S)-2-[(4-methoxyphenyl)methoxy]-1-phenylmethoxyethyl]oxirane |
| SMILES | COc1ccc(COC[C@H](OCc2ccccc2)[C@H]2CO2)cc1 |
| InChI | InChI=1S/C19H22O4/c1-20-17-9-7-16(8-10-17)11-21-13-18(19-14-23-19)22-12-15-5-3-2-4-6-15/h2-10,18-19H,11-14H2,1H3/t18-,19+/m0/s1 |
| InChIKey | RVYCYYGQSHNDTR-RBUKOAKNSA-N |
| XLogP | 3.20 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|