C25H30O5 — CID 11080102
(4S)-4-[(2R,3S)-1-[(4-methoxyphenyl)methoxy]-3-phenylmethoxypent-4-yn-2-yl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 11080102) has the molecular formula C25H30O5 and a molecular weight of 410.51 g/mol. Its IUPAC name is (4S)-4-[(2R,3S)-1-[(4-methoxyphenyl)methoxy]-3-phenylmethoxypent-4-yn-2-yl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4S)-4-[(2R,3S)-1-[(4-methoxyphenyl)methoxy]-3-phenylmethoxypent-4-yn-2-yl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 11080102 |
| Molecular Formula | C25H30O5 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | (4S)-4-[(2R,3S)-1-[(4-methoxyphenyl)methoxy]-3-phenylmethoxypent-4-yn-2-yl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | C#C[C@@H](OCc1ccccc1)[C@@H](COCc1ccc(OC)cc1)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C25H30O5/c1-5-23(28-16-19-9-7-6-8-10-19)22(24-18-29-25(2,3)30-24)17-27-15-20-11-13-21(26-4)14-12-20/h1,6-14,22-24H,15-18H2,2-4H3/t22-,23-,24-/m1/s1 |
| InChIKey | LNKJOGAZZSPBII-WXFUMESZSA-N |
| XLogP | 4.20 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|