C23H28O5 — CID 102375766
(4R)-2,2-dimethyl-4-[(1S,2R)-2-[(2R)-oxiran-2-yl]-1,2-bis(phenylmethoxy)ethyl]-1,3-dioxolane (PubChem CID 102375766) has the molecular formula C23H28O5 and a molecular weight of 384.47 g/mol. Its IUPAC name is (4R)-2,2-dimethyl-4-[(1S,2R)-2-[(2R)-oxiran-2-yl]-1,2-bis(phenylmethoxy)ethyl]-1,3-dioxolane.
| Compound Name | (4R)-2,2-dimethyl-4-[(1S,2R)-2-[(2R)-oxiran-2-yl]-1,2-bis(phenylmethoxy)ethyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 102375766 |
| Molecular Formula | C23H28O5 |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | (4R)-2,2-dimethyl-4-[(1S,2R)-2-[(2R)-oxiran-2-yl]-1,2-bis(phenylmethoxy)ethyl]-1,3-dioxolane |
| SMILES | CC1(C)OC[C@H]([C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]2CO2)O1 |
| InChI | InChI=1S/C23H28O5/c1-23(2)27-16-20(28-23)22(26-14-18-11-7-4-8-12-18)21(19-15-24-19)25-13-17-9-5-3-6-10-17/h3-12,19-22H,13-16H2,1-2H3/t19-,20-,21-,22+/m1/s1 |
| InChIKey | PQJCHUFWAMVBFV-YSFYHYPLSA-N |
| XLogP | 3.71 |
| TPSA | 49.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|