C30H36O6 — CID 15385583
(2S,3R,4S)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,3,4-tris(phenylmethoxy)butan-1-ol (PubChem CID 15385583) has the molecular formula C30H36O6 and a molecular weight of 492.61 g/mol. Its IUPAC name is (2S,3R,4S)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,3,4-tris(phenylmethoxy)butan-1-ol.
| Compound Name | (2S,3R,4S)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,3,4-tris(phenylmethoxy)butan-1-ol |
|---|---|
| PubChem CID | 15385583 |
| Molecular Formula | C30H36O6 |
| Molecular Weight | 492.61 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | (2S,3R,4S)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,3,4-tris(phenylmethoxy)butan-1-ol |
| SMILES | CC1(C)OC[C@H]([C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H](CO)OCc2ccccc2)O1 |
| InChI | InChI=1S/C30H36O6/c1-30(2)35-22-27(36-30)29(34-21-25-16-10-5-11-17-25)28(33-20-24-14-8-4-9-15-24)26(18-31)32-19-23-12-6-3-7-13-23/h3-17,26-29,31H,18-22H2,1-2H3/t26-,27+,28+,29-/m0/s1 |
| InChIKey | ANROOPONPZHVOX-AUAHOFGGSA-N |
| XLogP | 4.89 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.61 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |