C32H38O8 — CID 134883106
(3R,4S)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4-bis(phenylmethoxy)-1-(3,4,5-trimethoxyphenyl)butan-1-one (PubChem CID 134883106) has the molecular formula C32H38O8 and a molecular weight of 550.65 g/mol. Its IUPAC name is (3R,4S)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4-bis(phenylmethoxy)-1-(3,4,5-trimethoxyphenyl)butan-1-one.
| Compound Name | (3R,4S)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4-bis(phenylmethoxy)-1-(3,4,5-trimethoxyphenyl)butan-1-one |
|---|---|
| PubChem CID | 134883106 |
| Molecular Formula | C32H38O8 |
| Molecular Weight | 550.65 g/mol |
| Exact Mass | 550.26 |
| IUPAC Name | (3R,4S)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4-bis(phenylmethoxy)-1-(3,4,5-trimethoxyphenyl)butan-1-one |
| SMILES | COc1cc(C(=O)C[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]2COC(C)(C)O2)cc(OC)c1OC |
| InChI | InChI=1S/C32H38O8/c1-32(2)39-21-29(40-32)31(38-20-23-14-10-7-11-15-23)28(37-19-22-12-8-6-9-13-22)18-25(33)24-16-26(34-3)30(36-5)27(17-24)35-4/h6-17,28-29,31H,18-21H2,1-5H3/t28-,29-,31+/m1/s1 |
| InChIKey | RJNVBYHWYIGJPI-XQKNLLDYSA-N |
| XLogP | 5.61 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.65 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |