C17H24O3 — CID 15311099
(4R)-2,2-dimethyl-4-[(E,1R)-2-methyl-1-phenylmethoxybut-2-enyl]-1,3-dioxolane (PubChem CID 15311099) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is (4R)-2,2-dimethyl-4-[(E,1R)-2-methyl-1-phenylmethoxybut-2-enyl]-1,3-dioxolane.
| Compound Name | (4R)-2,2-dimethyl-4-[(E,1R)-2-methyl-1-phenylmethoxybut-2-enyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 15311099 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | (4R)-2,2-dimethyl-4-[(E,1R)-2-methyl-1-phenylmethoxybut-2-enyl]-1,3-dioxolane |
| SMILES | C/C=C(\C)[C@@H](OCc1ccccc1)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C17H24O3/c1-5-13(2)16(15-12-19-17(3,4)20-15)18-11-14-9-7-6-8-10-14/h5-10,15-16H,11-12H2,1-4H3/b13-5+/t15-,16-/m1/s1 |
| InChIKey | MEUBMSHFEUADDI-DUHLTWJFSA-N |
| XLogP | 3.69 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|