C17H24O4 — CID 134906102
(1R,2S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-phenylmethoxypent-4-en-2-ol (PubChem CID 134906102) has the molecular formula C17H24O4 and a molecular weight of 292.37 g/mol. Its IUPAC name is (1R,2S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-phenylmethoxypent-4-en-2-ol.
| Compound Name | (1R,2S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-phenylmethoxypent-4-en-2-ol |
|---|---|
| PubChem CID | 134906102 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | (1R,2S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-phenylmethoxypent-4-en-2-ol |
| SMILES | C=CC[C@H](O)[C@@H](OCc1ccccc1)[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C17H24O4/c1-4-8-14(18)16(15-12-20-17(2,3)21-15)19-11-13-9-6-5-7-10-13/h4-7,9-10,14-16,18H,1,8,11-12H2,2-3H3/t14-,15-,16+/m0/s1 |
| InChIKey | MEENXIBHFBABEN-HRCADAONSA-N |
| XLogP | 2.66 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|