C34H40O7 — CID 11478530
ethyl (E,4S,5R,6R)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,5,6-tris(phenylmethoxy)hex-2-enoate (PubChem CID 11478530) has the molecular formula C34H40O7 and a molecular weight of 560.69 g/mol. Its IUPAC name is ethyl (E,4S,5R,6R)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,5,6-tris(phenylmethoxy)hex-2-enoate.
| Compound Name | ethyl (E,4S,5R,6R)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,5,6-tris(phenylmethoxy)hex-2-enoate |
|---|---|
| PubChem CID | 11478530 |
| Molecular Formula | C34H40O7 |
| Molecular Weight | 560.69 g/mol |
| Exact Mass | 560.28 |
| IUPAC Name | ethyl (E,4S,5R,6R)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,5,6-tris(phenylmethoxy)hex-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C34H40O7/c1-4-36-31(35)21-20-29(37-22-26-14-8-5-9-15-26)32(38-23-27-16-10-6-11-17-27)33(30-25-40-34(2,3)41-30)39-24-28-18-12-7-13-19-28/h5-21,29-30,32-33H,4,22-25H2,1-3H3/b21-20+/t29-,30+,32+,33+/m0/s1 |
| InChIKey | BERCWNMUDUUTRT-XXMNOADCSA-N |
| XLogP | 6.01 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.69 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|