C33H36O6 — CID 101166628
ethyl (2E,4R,5R,6S,7E)-9-oxo-4,5,6-tris(phenylmethoxy)deca-2,7-dienoate (PubChem CID 101166628) has the molecular formula C33H36O6 and a molecular weight of 528.65 g/mol. Its IUPAC name is ethyl (2E,4R,5R,6S,7E)-9-oxo-4,5,6-tris(phenylmethoxy)deca-2,7-dienoate.
| Compound Name | ethyl (2E,4R,5R,6S,7E)-9-oxo-4,5,6-tris(phenylmethoxy)deca-2,7-dienoate |
|---|---|
| PubChem CID | 101166628 |
| Molecular Formula | C33H36O6 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.25 |
| IUPAC Name | ethyl (2E,4R,5R,6S,7E)-9-oxo-4,5,6-tris(phenylmethoxy)deca-2,7-dienoate |
| SMILES | CCOC(=O)/C=C/[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@H](/C=C/C(C)=O)OCc1ccccc1 |
| InChI | InChI=1S/C33H36O6/c1-3-36-32(35)22-21-31(38-24-28-15-9-5-10-16-28)33(39-25-29-17-11-6-12-18-29)30(20-19-26(2)34)37-23-27-13-7-4-8-14-27/h4-22,30-31,33H,3,23-25H2,1-2H3/b20-19+,22-21+/t30-,31+,33+/m0/s1 |
| InChIKey | QSDIAUJVUZSZPU-UNEGZHTCSA-N |
| XLogP | 6.01 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|