C35H44O5S2 — CID 101131344
methyl (Z,4S,5S,6R)-4,5,6-tris(phenylmethoxy)-7,7-bis(propylsulfanyl)hept-2-enoate (PubChem CID 101131344) has the molecular formula C35H44O5S2 and a molecular weight of 608.87 g/mol. Its IUPAC name is methyl (Z,4S,5S,6R)-4,5,6-tris(phenylmethoxy)-7,7-bis(propylsulfanyl)hept-2-enoate.
| Compound Name | methyl (Z,4S,5S,6R)-4,5,6-tris(phenylmethoxy)-7,7-bis(propylsulfanyl)hept-2-enoate |
|---|---|
| PubChem CID | 101131344 |
| Molecular Formula | C35H44O5S2 |
| Molecular Weight | 608.87 g/mol |
| Exact Mass | 608.26 |
| IUPAC Name | methyl (Z,4S,5S,6R)-4,5,6-tris(phenylmethoxy)-7,7-bis(propylsulfanyl)hept-2-enoate |
| SMILES | CCCSC(SCCC)[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](/C=C\C(=O)OC)OCc1ccccc1 |
| InChI | InChI=1S/C35H44O5S2/c1-4-23-41-35(42-24-5-2)34(40-27-30-19-13-8-14-20-30)33(39-26-29-17-11-7-12-18-29)31(21-22-32(36)37-3)38-25-28-15-9-6-10-16-28/h6-22,31,33-35H,4-5,23-27H2,1-3H3/b22-21-/t31-,33-,34+/m0/s1 |
| InChIKey | UPWOAUHCWONCER-YSRPSJGWSA-N |
| XLogP | 8.08 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.87 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|