C36H66O6Si3 — CID 66572585
methyl (2Z,4S,5S,6E,8S,9S)-5,8,9-tris[[tert-butyl(dimethyl)silyl]oxy]-4-phenylmethoxydeca-2,6-dienoate (PubChem CID 66572585) has the molecular formula C36H66O6Si3 and a molecular weight of 679.18 g/mol. Its IUPAC name is methyl (2Z,4S,5S,6E,8S,9S)-5,8,9-tris[[tert-butyl(dimethyl)silyl]oxy]-4-phenylmethoxydeca-2,6-dienoate.
| Compound Name | methyl (2Z,4S,5S,6E,8S,9S)-5,8,9-tris[[tert-butyl(dimethyl)silyl]oxy]-4-phenylmethoxydeca-2,6-dienoate |
|---|---|
| PubChem CID | 66572585 |
| Molecular Formula | C36H66O6Si3 |
| Molecular Weight | 679.18 g/mol |
| Exact Mass | 678.42 |
| IUPAC Name | methyl (2Z,4S,5S,6E,8S,9S)-5,8,9-tris[[tert-butyl(dimethyl)silyl]oxy]-4-phenylmethoxydeca-2,6-dienoate |
| SMILES | COC(=O)/C=C\[C@H](OCc1ccccc1)[C@H](/C=C/[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C36H66O6Si3/c1-28(40-43(12,13)34(2,3)4)30(41-44(14,15)35(5,6)7)23-24-32(42-45(16,17)36(8,9)10)31(25-26-33(37)38-11)39-27-29-21-19-18-20-22-29/h18-26,28,30-32H,27H2,1-17H3/b24-23+,26-25-/t28-,30-,31-,32-/m0/s1 |
| InChIKey | DQRDHMAXZSOUNZ-DVVQUHRUSA-N |
| XLogP | 10.05 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.18 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|