C37H52O9Si — CID 11093606
[(2S)-4-methoxy-4-oxobutan-2-yl] (E,4R,5S)-5-[(E,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxyhex-2-enoyl]oxy-4-phenylmethoxyhex-2-enoate (PubChem CID 11093606) has the molecular formula C37H52O9Si and a molecular weight of 668.90 g/mol. Its IUPAC name is [(2S)-4-methoxy-4-oxobutan-2-yl] (E,4R,5S)-5-[(E,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxyhex-2-enoyl]oxy-4-phenylmethoxyhex-2-enoate.
| Compound Name | [(2S)-4-methoxy-4-oxobutan-2-yl] (E,4R,5S)-5-[(E,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxyhex-2-enoyl]oxy-4-phenylmethoxyhex-2-enoate |
|---|---|
| PubChem CID | 11093606 |
| Molecular Formula | C37H52O9Si |
| Molecular Weight | 668.90 g/mol |
| Exact Mass | 668.34 |
| IUPAC Name | [(2S)-4-methoxy-4-oxobutan-2-yl] (E,4R,5S)-5-[(E,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxyhex-2-enoyl]oxy-4-phenylmethoxyhex-2-enoate |
| SMILES | COC(=O)C[C@H](C)OC(=O)/C=C/[C@@H](OCc1ccccc1)[C@H](C)OC(=O)/C=C/[C@@H](OCc1ccccc1)[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C37H52O9Si/c1-27(24-36(40)41-7)44-34(38)22-20-32(42-25-30-16-12-10-13-17-30)28(2)45-35(39)23-21-33(43-26-31-18-14-11-15-19-31)29(3)46-47(8,9)37(4,5)6/h10-23,27-29,32-33H,24-26H2,1-9H3/b22-20+,23-21+/t27-,28-,29-,32+,33+/m0/s1 |
| InChIKey | ROBRCHDLCUNYAC-XEFHAGGVSA-N |
| XLogP | 7.11 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.90 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|