C18H30O2Si — CID 138976638
tert-butyl-dimethyl-[(3S,4S)-4-phenylmethoxypent-1-en-3-yl]oxysilane (PubChem CID 138976638) has the molecular formula C18H30O2Si and a molecular weight of 306.52 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(3S,4S)-4-phenylmethoxypent-1-en-3-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(3S,4S)-4-phenylmethoxypent-1-en-3-yl]oxysilane |
|---|---|
| PubChem CID | 138976638 |
| Molecular Formula | C18H30O2Si |
| Molecular Weight | 306.52 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | tert-butyl-dimethyl-[(3S,4S)-4-phenylmethoxypent-1-en-3-yl]oxysilane |
| SMILES | C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)OCc1ccccc1 |
| InChI | InChI=1S/C18H30O2Si/c1-8-17(20-21(6,7)18(3,4)5)15(2)19-14-16-12-10-9-11-13-16/h8-13,15,17H,1,14H2,2-7H3/t15-,17-/m0/s1 |
| InChIKey | ZCOQAEZKUTWLOA-RDJZCZTQSA-N |
| XLogP | 5.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.52 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|