C32H46O5Si — CID 10697681
[(5R,6S,7R,8R)-8-[tert-butyl(dimethyl)silyl]oxy-6,7-bis(phenylmethoxy)deca-1,9-dien-5-yl] acetate (PubChem CID 10697681) has the molecular formula C32H46O5Si and a molecular weight of 538.80 g/mol. Its IUPAC name is [(5R,6S,7R,8R)-8-[tert-butyl(dimethyl)silyl]oxy-6,7-bis(phenylmethoxy)deca-1,9-dien-5-yl] acetate.
| Compound Name | [(5R,6S,7R,8R)-8-[tert-butyl(dimethyl)silyl]oxy-6,7-bis(phenylmethoxy)deca-1,9-dien-5-yl] acetate |
|---|---|
| PubChem CID | 10697681 |
| Molecular Formula | C32H46O5Si |
| Molecular Weight | 538.80 g/mol |
| Exact Mass | 538.31 |
| IUPAC Name | [(5R,6S,7R,8R)-8-[tert-butyl(dimethyl)silyl]oxy-6,7-bis(phenylmethoxy)deca-1,9-dien-5-yl] acetate |
| SMILES | C=CCC[C@@H](OC(C)=O)[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@@H](C=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H46O5Si/c1-9-11-22-29(36-25(3)33)31(35-24-27-20-16-13-17-21-27)30(34-23-26-18-14-12-15-19-26)28(10-2)37-38(7,8)32(4,5)6/h9-10,12-21,28-31H,1-2,11,22-24H2,3-8H3/t28-,29-,30+,31+/m1/s1 |
| InChIKey | AWQIONVASLBFBV-VKONIRKNSA-N |
| XLogP | 7.63 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.80 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|