C22H26O5 — CID 101392493
[(2R,3R)-4-hydroxy-1,3-bis(phenylmethoxy)hex-5-en-2-yl] acetate (PubChem CID 101392493) has the molecular formula C22H26O5 and a molecular weight of 370.44 g/mol. Its IUPAC name is [(2R,3R)-4-hydroxy-1,3-bis(phenylmethoxy)hex-5-en-2-yl] acetate.
| Compound Name | [(2R,3R)-4-hydroxy-1,3-bis(phenylmethoxy)hex-5-en-2-yl] acetate |
|---|---|
| PubChem CID | 101392493 |
| Molecular Formula | C22H26O5 |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | [(2R,3R)-4-hydroxy-1,3-bis(phenylmethoxy)hex-5-en-2-yl] acetate |
| SMILES | C=CC(O)[C@@H](OCc1ccccc1)[C@@H](COCc1ccccc1)OC(C)=O |
| InChI | InChI=1S/C22H26O5/c1-3-20(24)22(26-15-19-12-8-5-9-13-19)21(27-17(2)23)16-25-14-18-10-6-4-7-11-18/h3-13,20-22,24H,1,14-16H2,2H3/t20?,21-,22-/m1/s1 |
| InChIKey | CPVPHURQSSCQIE-HRUVVLKGSA-N |
| XLogP | 3.27 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|