C16H22O3 — CID 15942144
[(3S,4R)-4-methyl-1-phenylmethoxyhex-5-en-3-yl] acetate (PubChem CID 15942144) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is [(3S,4R)-4-methyl-1-phenylmethoxyhex-5-en-3-yl] acetate.
| Compound Name | [(3S,4R)-4-methyl-1-phenylmethoxyhex-5-en-3-yl] acetate |
|---|---|
| PubChem CID | 15942144 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | [(3S,4R)-4-methyl-1-phenylmethoxyhex-5-en-3-yl] acetate |
| SMILES | C=C[C@@H](C)[C@H](CCOCc1ccccc1)OC(C)=O |
| InChI | InChI=1S/C16H22O3/c1-4-13(2)16(19-14(3)17)10-11-18-12-15-8-6-5-7-9-15/h4-9,13,16H,1,10-12H2,2-3H3/t13-,16+/m1/s1 |
| InChIKey | RPPCQFBNYURSTR-CJNGLKHVSA-N |
| XLogP | 3.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|