C20H26O9 — CID 101133703
[(2R,3S,4S)-2,3,4-triacetyloxy-5-phenylmethoxypentyl] acetate (PubChem CID 101133703) has the molecular formula C20H26O9 and a molecular weight of 410.42 g/mol. Its IUPAC name is [(2R,3S,4S)-2,3,4-triacetyloxy-5-phenylmethoxypentyl] acetate.
| Compound Name | [(2R,3S,4S)-2,3,4-triacetyloxy-5-phenylmethoxypentyl] acetate |
|---|---|
| PubChem CID | 101133703 |
| Molecular Formula | C20H26O9 |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | [(2R,3S,4S)-2,3,4-triacetyloxy-5-phenylmethoxypentyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](COCc1ccccc1)OC(C)=O |
| InChI | InChI=1S/C20H26O9/c1-13(21)26-12-19(28-15(3)23)20(29-16(4)24)18(27-14(2)22)11-25-10-17-8-6-5-7-9-17/h5-9,18-20H,10-12H2,1-4H3/t18-,19+,20-/m0/s1 |
| InChIKey | ZTDMJYKSZGFNIQ-ZCNNSNEGSA-N |
| XLogP | 1.56 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|