C23H31NO10 — CID 129257693
[(2R,3S,4R,5S)-2,3,4-triacetyloxy-5-(phenylmethoxycarbonylamino)heptyl] acetate (PubChem CID 129257693) has the molecular formula C23H31NO10 and a molecular weight of 481.50 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-2,3,4-triacetyloxy-5-(phenylmethoxycarbonylamino)heptyl] acetate.
| Compound Name | [(2R,3S,4R,5S)-2,3,4-triacetyloxy-5-(phenylmethoxycarbonylamino)heptyl] acetate |
|---|---|
| PubChem CID | 129257693 |
| Molecular Formula | C23H31NO10 |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | [(2R,3S,4R,5S)-2,3,4-triacetyloxy-5-(phenylmethoxycarbonylamino)heptyl] acetate |
| SMILES | CC[C@H](NC(=O)OCc1ccccc1)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C23H31NO10/c1-6-19(24-23(29)31-12-18-10-8-7-9-11-18)21(33-16(4)27)22(34-17(5)28)20(32-15(3)26)13-30-14(2)25/h7-11,19-22H,6,12-13H2,1-5H3,(H,24,29)/t19-,20+,21+,22+/m0/s1 |
| InChIKey | WZCWUPIGOPIFPJ-DXBBTUNJSA-N |
| XLogP | 2.05 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|