C17H22O7 — CID 10806920
[(2S,3S)-3,4-diacetyloxy-2-phenylmethoxybutyl] acetate (PubChem CID 10806920) has the molecular formula C17H22O7 and a molecular weight of 338.36 g/mol. Its IUPAC name is [(2S,3S)-3,4-diacetyloxy-2-phenylmethoxybutyl] acetate.
| Compound Name | [(2S,3S)-3,4-diacetyloxy-2-phenylmethoxybutyl] acetate |
|---|---|
| PubChem CID | 10806920 |
| Molecular Formula | C17H22O7 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | [(2S,3S)-3,4-diacetyloxy-2-phenylmethoxybutyl] acetate |
| SMILES | CC(=O)OC[C@H](OCc1ccccc1)[C@H](COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C17H22O7/c1-12(18)21-10-16(23-9-15-7-5-4-6-8-15)17(24-14(3)20)11-22-13(2)19/h4-8,16-17H,9-11H2,1-3H3/t16-,17-/m0/s1 |
| InChIKey | DEUJAJDUNNZHNE-IRXDYDNUSA-N |
| XLogP | 1.63 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|