C20H24O5 — CID 101029598
[(2S,3S)-3-hydroxy-1,4-bis(phenylmethoxy)butan-2-yl] acetate (PubChem CID 101029598) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is [(2S,3S)-3-hydroxy-1,4-bis(phenylmethoxy)butan-2-yl] acetate.
| Compound Name | [(2S,3S)-3-hydroxy-1,4-bis(phenylmethoxy)butan-2-yl] acetate |
|---|---|
| PubChem CID | 101029598 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | [(2S,3S)-3-hydroxy-1,4-bis(phenylmethoxy)butan-2-yl] acetate |
| SMILES | CC(=O)O[C@@H](COCc1ccccc1)[C@@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C20H24O5/c1-16(21)25-20(15-24-13-18-10-6-3-7-11-18)19(22)14-23-12-17-8-4-2-5-9-17/h2-11,19-20,22H,12-15H2,1H3/t19-,20-/m0/s1 |
| InChIKey | QDQNRTSXNYVMPC-PMACEKPBSA-N |
| XLogP | 2.71 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |