C18H20O4 — CID 10566133
(2S,3S)-2-benzyl-3-hydroxy-4-phenylmethoxybutanoic acid (PubChem CID 10566133) has the molecular formula C18H20O4 and a molecular weight of 300.35 g/mol. Its IUPAC name is (2S,3S)-2-benzyl-3-hydroxy-4-phenylmethoxybutanoic acid.
| Compound Name | (2S,3S)-2-benzyl-3-hydroxy-4-phenylmethoxybutanoic acid |
|---|---|
| PubChem CID | 10566133 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | (2S,3S)-2-benzyl-3-hydroxy-4-phenylmethoxybutanoic acid |
| SMILES | O=C(O)[C@@H](Cc1ccccc1)[C@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C18H20O4/c19-17(13-22-12-15-9-5-2-6-10-15)16(18(20)21)11-14-7-3-1-4-8-14/h1-10,16-17,19H,11-13H2,(H,20,21)/t16-,17+/m0/s1 |
| InChIKey | BYYJZZKGOOWLBA-DLBZAZTESA-N |
| XLogP | 2.51 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |