C31H34O7 — CID 14312025
[(E)-5-acetyloxy-2,4,6-tris(phenylmethoxy)hex-2-enyl] acetate (PubChem CID 14312025) has the molecular formula C31H34O7 and a molecular weight of 518.61 g/mol. Its IUPAC name is [(E)-5-acetyloxy-2,4,6-tris(phenylmethoxy)hex-2-enyl] acetate.
| Compound Name | [(E)-5-acetyloxy-2,4,6-tris(phenylmethoxy)hex-2-enyl] acetate |
|---|---|
| PubChem CID | 14312025 |
| Molecular Formula | C31H34O7 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.23 |
| IUPAC Name | [(E)-5-acetyloxy-2,4,6-tris(phenylmethoxy)hex-2-enyl] acetate |
| SMILES | CC(=O)OC/C(=C\C(OCc1ccccc1)C(COCc1ccccc1)OC(C)=O)OCc1ccccc1 |
| InChI | InChI=1S/C31H34O7/c1-24(32)35-22-29(36-20-27-14-8-4-9-15-27)18-30(37-21-28-16-10-5-11-17-28)31(38-25(2)33)23-34-19-26-12-6-3-7-13-26/h3-18,30-31H,19-23H2,1-2H3/b29-18+ |
| InChIKey | PATVFBPWOIVBOA-RDRPBHBLSA-N |
| XLogP | 5.38 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|