C40H44O8 — CID 24857975
[(2R,3R,4R,5S,6S)-6-acetyloxy-1,3,4,5-tetrakis(phenylmethoxy)oct-7-en-2-yl] acetate (PubChem CID 24857975) has the molecular formula C40H44O8 and a molecular weight of 652.78 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6S)-6-acetyloxy-1,3,4,5-tetrakis(phenylmethoxy)oct-7-en-2-yl] acetate.
| Compound Name | [(2R,3R,4R,5S,6S)-6-acetyloxy-1,3,4,5-tetrakis(phenylmethoxy)oct-7-en-2-yl] acetate |
|---|---|
| PubChem CID | 24857975 |
| Molecular Formula | C40H44O8 |
| Molecular Weight | 652.78 g/mol |
| Exact Mass | 652.30 |
| IUPAC Name | [(2R,3R,4R,5S,6S)-6-acetyloxy-1,3,4,5-tetrakis(phenylmethoxy)oct-7-en-2-yl] acetate |
| SMILES | C=C[C@H](OC(C)=O)[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](COCc1ccccc1)OC(C)=O |
| InChI | InChI=1S/C40H44O8/c1-4-36(47-30(2)41)38(44-26-33-19-11-6-12-20-33)40(46-28-35-23-15-8-16-24-35)39(45-27-34-21-13-7-14-22-34)37(48-31(3)42)29-43-25-32-17-9-5-10-18-32/h4-24,36-40H,1,25-29H2,2-3H3/t36-,37+,38-,39+,40+/m0/s1 |
| InChIKey | FMOCWSUXTQMIHE-WBHVZLLVSA-N |
| XLogP | 7.01 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.78 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|