C33H38O5 — CID 15498900
[(5S,6S,7S,8R)-6,7,8-tris(phenylmethoxy)deca-1,9-dien-5-yl] acetate (PubChem CID 15498900) has the molecular formula C33H38O5 and a molecular weight of 514.66 g/mol. Its IUPAC name is [(5S,6S,7S,8R)-6,7,8-tris(phenylmethoxy)deca-1,9-dien-5-yl] acetate.
| Compound Name | [(5S,6S,7S,8R)-6,7,8-tris(phenylmethoxy)deca-1,9-dien-5-yl] acetate |
|---|---|
| PubChem CID | 15498900 |
| Molecular Formula | C33H38O5 |
| Molecular Weight | 514.66 g/mol |
| Exact Mass | 514.27 |
| IUPAC Name | [(5S,6S,7S,8R)-6,7,8-tris(phenylmethoxy)deca-1,9-dien-5-yl] acetate |
| SMILES | C=CCC[C@H](OC(C)=O)[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@@H](C=C)OCc1ccccc1 |
| InChI | InChI=1S/C33H38O5/c1-4-6-22-31(38-26(3)34)33(37-25-29-20-14-9-15-21-29)32(36-24-28-18-12-8-13-19-28)30(5-2)35-23-27-16-10-7-11-17-27/h4-5,7-21,30-33H,1-2,6,22-25H2,3H3/t30-,31+,32+,33+/m1/s1 |
| InChIKey | FLMOFGMLKMKBFO-GJBCSVNNSA-N |
| XLogP | 6.83 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.66 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|