C22H31NO5 — CID 53354852
[(4S,5S,6S)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenylmethoxyocta-1,7-dien-4-yl] acetate (PubChem CID 53354852) has the molecular formula C22H31NO5 and a molecular weight of 389.49 g/mol. Its IUPAC name is [(4S,5S,6S)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenylmethoxyocta-1,7-dien-4-yl] acetate.
| Compound Name | [(4S,5S,6S)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenylmethoxyocta-1,7-dien-4-yl] acetate |
|---|---|
| PubChem CID | 53354852 |
| Molecular Formula | C22H31NO5 |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | [(4S,5S,6S)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenylmethoxyocta-1,7-dien-4-yl] acetate |
| SMILES | C=CC[C@H](OC(C)=O)[C@H](NC(=O)OC(C)(C)C)[C@H](C=C)OCc1ccccc1 |
| InChI | InChI=1S/C22H31NO5/c1-7-12-19(27-16(3)24)20(23-21(25)28-22(4,5)6)18(8-2)26-15-17-13-10-9-11-14-17/h7-11,13-14,18-20H,1-2,12,15H2,3-6H3,(H,23,25)/t18-,19-,20+/m0/s1 |
| InChIKey | BLMJXDYSCIEILU-SLFFLAALSA-N |
| XLogP | 4.16 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|