C22H32O5 — CID 157380903
4-O-tert-butyl 1-O-[(2S,3R)-3-phenylmethoxyhex-5-en-2-yl] (2R)-2-methylbutanedioate (PubChem CID 157380903) has the molecular formula C22H32O5 and a molecular weight of 376.49 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-[(2S,3R)-3-phenylmethoxyhex-5-en-2-yl] (2R)-2-methylbutanedioate.
| Compound Name | 4-O-tert-butyl 1-O-[(2S,3R)-3-phenylmethoxyhex-5-en-2-yl] (2R)-2-methylbutanedioate |
|---|---|
| PubChem CID | 157380903 |
| Molecular Formula | C22H32O5 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 4-O-tert-butyl 1-O-[(2S,3R)-3-phenylmethoxyhex-5-en-2-yl] (2R)-2-methylbutanedioate |
| SMILES | C=CC[C@@H](OCc1ccccc1)[C@H](C)OC(=O)[C@H](C)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H32O5/c1-7-11-19(25-15-18-12-9-8-10-13-18)17(3)26-21(24)16(2)14-20(23)27-22(4,5)6/h7-10,12-13,16-17,19H,1,11,14-15H2,2-6H3/t16-,17+,19-/m1/s1 |
| InChIKey | IZLMNLSHHSDQOJ-ZIFCJYIRSA-N |
| XLogP | 4.45 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|