C21H32O5 — CID 159281256
4-O-tert-butyl 1-O-[(3R)-2-phenoxyhexan-3-yl] (2R)-2-methylbutanedioate (PubChem CID 159281256) has the molecular formula C21H32O5 and a molecular weight of 364.48 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-[(3R)-2-phenoxyhexan-3-yl] (2R)-2-methylbutanedioate.
| Compound Name | 4-O-tert-butyl 1-O-[(3R)-2-phenoxyhexan-3-yl] (2R)-2-methylbutanedioate |
|---|---|
| PubChem CID | 159281256 |
| Molecular Formula | C21H32O5 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 4-O-tert-butyl 1-O-[(3R)-2-phenoxyhexan-3-yl] (2R)-2-methylbutanedioate |
| SMILES | CCC[C@@H](OC(=O)[C@H](C)CC(=O)OC(C)(C)C)C(C)Oc1ccccc1 |
| InChI | InChI=1S/C21H32O5/c1-7-11-18(16(3)24-17-12-9-8-10-13-17)25-20(23)15(2)14-19(22)26-21(4,5)6/h8-10,12-13,15-16,18H,7,11,14H2,1-6H3/t15-,16?,18-/m1/s1 |
| InChIKey | KYYFTULEWNOPBU-IFJNFQAOSA-N |
| XLogP | 4.53 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |