C15H23NO3 — CID 121462537
[(2S,3R)-2-phenoxyhexan-3-yl] (2S)-2-aminopropanoate (PubChem CID 121462537) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is [(2S,3R)-2-phenoxyhexan-3-yl] (2S)-2-aminopropanoate.
| Compound Name | [(2S,3R)-2-phenoxyhexan-3-yl] (2S)-2-aminopropanoate |
|---|---|
| PubChem CID | 121462537 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | [(2S,3R)-2-phenoxyhexan-3-yl] (2S)-2-aminopropanoate |
| SMILES | CCC[C@@H](OC(=O)[C@H](C)N)[C@H](C)Oc1ccccc1 |
| InChI | InChI=1S/C15H23NO3/c1-4-8-14(19-15(17)11(2)16)12(3)18-13-9-6-5-7-10-13/h5-7,9-12,14H,4,8,16H2,1-3H3/t11-,12-,14+/m0/s1 |
| InChIKey | GJIOECBTOBHTNR-SGMGOOAPSA-N |
| XLogP | 2.51 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |